C5H16BrNO6P2 — CID 172830708
[bromo(phosphono)methyl]phosphonic acid;N-ethylethanamine (PubChem CID 172830708) has the molecular formula C5H16BrNO6P2 and a molecular weight of 328.04 g/mol. Its IUPAC name is [bromo(phosphono)methyl]phosphonic acid;N-ethylethanamine.
| Compound Name | [bromo(phosphono)methyl]phosphonic acid;N-ethylethanamine |
|---|---|
| PubChem CID | 172830708 |
| Molecular Formula | C5H16BrNO6P2 |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | [bromo(phosphono)methyl]phosphonic acid;N-ethylethanamine |
| SMILES | CCNCC.O=P(O)(O)C(Br)P(=O)(O)O |
| InChI | InChI=1S/C4H11N.CH5BrO6P2/c1-3-5-4-2;2-1(9(3,4)5)10(6,7)8/h5H,3-4H2,1-2H3;1H,(H2,3,4,5)(H2,6,7,8) |
| InChIKey | VLYXAYPEFUPOGG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|