C10H14F3NO4 — CID 172831343
4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 172831343) has the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172831343 |
| Molecular Formula | C10H14F3NO4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | C/C=C\C1CNC(C(=O)O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H13NO2.C2HF3O2/c1-2-3-6-4-7(8(10)11)9-5-6;3-2(4,5)1(6)7/h2-3,6-7,9H,4-5H2,1H3,(H,10,11);(H,6,7)/b3-2-; |
| InChIKey | VNZQYFOVJATMDW-OLGQORCHSA-N |
| XLogP | 1.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|