C14H20O4 — CID 172831859
(2,2-dimethyl-1,3-dioxolan-4-yl) 1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 172831859) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl) 1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl) 1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 172831859 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl) 1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C)OCC(OC(=O)C2CC3C=CC2(C)C3)O1 |
| InChI | InChI=1S/C14H20O4/c1-13(2)16-8-11(18-13)17-12(15)10-6-9-4-5-14(10,3)7-9/h4-5,9-11H,6-8H2,1-3H3 |
| InChIKey | VPSFBCYKIRRHHT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|