C15H24O4 — CID 44603759
ethyl 2-[(1R,5R,6S)-6-(1,3-dioxolan-2-yl)-5,6-dimethylcyclohex-2-en-1-yl]acetate (PubChem CID 44603759) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is ethyl 2-[(1R,5R,6S)-6-(1,3-dioxolan-2-yl)-5,6-dimethylcyclohex-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,5R,6S)-6-(1,3-dioxolan-2-yl)-5,6-dimethylcyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 44603759 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ethyl 2-[(1R,5R,6S)-6-(1,3-dioxolan-2-yl)-5,6-dimethylcyclohex-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C=CC[C@@H](C)[C@]1(C)C1OCCO1 |
| InChI | InChI=1S/C15H24O4/c1-4-17-13(16)10-12-7-5-6-11(2)15(12,3)14-18-8-9-19-14/h5,7,11-12,14H,4,6,8-10H2,1-3H3/t11-,12+,15+/m1/s1 |
| InChIKey | QQCZQJWESBVWJR-XUJVJEKNSA-N |
| XLogP | 2.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|