C15H20N4O2S — CID 17283635
1-(3,5-dimethoxyphenyl)-3-[(1,5-dimethylpyrazol-4-yl)methyl]thiourea (PubChem CID 17283635) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[(1,5-dimethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[(1,5-dimethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 17283635 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[(1,5-dimethylpyrazol-4-yl)methyl]thiourea |
| SMILES | COc1cc(NC(=S)NCc2cnn(C)c2C)cc(OC)c1 |
| InChI | InChI=1S/C15H20N4O2S/c1-10-11(9-17-19(10)2)8-16-15(22)18-12-5-13(20-3)7-14(6-12)21-4/h5-7,9H,8H2,1-4H3,(H2,16,18,22) |
| InChIKey | LCNVORNAKCHKSV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|