C15H12FN5Na — CID 172837950
CID 172837950 (PubChem CID 172837950) has the molecular formula C15H12FN5Na and a molecular weight of 304.28 g/mol.
| Compound Name | CID 172837950 |
|---|---|
| PubChem CID | 172837950 |
| Molecular Formula | C15H12FN5Na |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | — |
| SMILES | Nc1nc(N)c(-c2ccncc2)c(-c2cccc(F)c2)n1.[Na] |
| InChI | InChI=1S/C15H12FN5.Na/c16-11-3-1-2-10(8-11)13-12(9-4-6-19-7-5-9)14(17)21-15(18)20-13;/h1-8H,(H4,17,18,20,21); |
| InChIKey | WKIJANLWKZSRIE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |