C27H24N6O2S — CID 172839293
4-(cyclopropylamino)-N-[1-[(4-methoxyanilino)methyl]isoquinolin-3-yl]thieno[3,2-d]pyrimidine-2-carboxamide (PubChem CID 172839293) has the molecular formula C27H24N6O2S and a molecular weight of 496.60 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[1-[(4-methoxyanilino)methyl]isoquinolin-3-yl]thieno[3,2-d]pyrimidine-2-carboxamide.
| Compound Name | 4-(cyclopropylamino)-N-[1-[(4-methoxyanilino)methyl]isoquinolin-3-yl]thieno[3,2-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 172839293 |
| Molecular Formula | C27H24N6O2S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-(cyclopropylamino)-N-[1-[(4-methoxyanilino)methyl]isoquinolin-3-yl]thieno[3,2-d]pyrimidine-2-carboxamide |
| SMILES | COc1ccc(NCc2nc(NC(=O)c3nc(NC4CC4)c4sccc4n3)cc3ccccc23)cc1 |
| InChI | InChI=1S/C27H24N6O2S/c1-35-19-10-8-17(9-11-19)28-15-22-20-5-3-2-4-16(20)14-23(30-22)32-27(34)26-31-21-12-13-36-24(21)25(33-26)29-18-6-7-18/h2-5,8-14,18,28H,6-7,15H2,1H3,(H,29,31,33)(H,30,32,34) |
| InChIKey | WORGWKXHODTNOF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|