C27H18NNaS2 — CID 172839422
sodium N,N-bis(9H-fluoren-1-yl)carbamodithioate (PubChem CID 172839422) has the molecular formula C27H18NNaS2 and a molecular weight of 443.57 g/mol. Its IUPAC name is sodium N,N-bis(9H-fluoren-1-yl)carbamodithioate.
| Compound Name | sodium N,N-bis(9H-fluoren-1-yl)carbamodithioate |
|---|---|
| PubChem CID | 172839422 |
| Molecular Formula | C27H18NNaS2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | sodium N,N-bis(9H-fluoren-1-yl)carbamodithioate |
| SMILES | S=C([S-])N(c1cccc2c1Cc1ccccc1-2)c1cccc2c1Cc1ccccc1-2.[Na+] |
| InChI | InChI=1S/C27H19NS2.Na/c29-27(30)28(25-13-5-11-21-19-9-3-1-7-17(19)15-23(21)25)26-14-6-12-22-20-10-4-2-8-18(20)16-24(22)26;/h1-14H,15-16H2,(H,29,30);/q;+1/p-1 |
| InChIKey | WPCDXVUFUCYHAM-UHFFFAOYSA-M |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|