About Fluorenylsilane
Fluorenylsilane (PubChem CID 22104606) has the molecular formula C13H9Si
and a molecular weight of 193.30 g/mol.
Molecular Properties
| Compound Name | Fluorenylsilane |
| PubChem CID | 22104606 |
| Molecular Formula | C13H9Si |
| Molecular Weight | 193.30 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | — |
| SMILES | [Si]c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9Si/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-7H,8H2 |
| InChIKey | VSKCUSCJJIRTTK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Fluorenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Fluorenylsilane?
The IUPAC name of Fluorenylsilane (CID 22104606) is not available.
What is the SMILES notation for Fluorenylsilane?
The canonical SMILES for Fluorenylsilane is [Si]c1cccc2c1Cc1ccccc1-2.
What is the InChIKey of Fluorenylsilane?
The InChIKey is VSKCUSCJJIRTTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Si/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-7H,8H2.
What are the key properties of Fluorenylsilane?
Fluorenylsilane has a molecular weight of 193.30 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Fluorenylsilane is sourced from PubChem (CID 22104606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).