C9H11NO7 — CID 172842691
(2R,3R)-2,3-dihydroxybutanedioic acid;2H-pyridin-3-one (PubChem CID 172842691) has the molecular formula C9H11NO7 and a molecular weight of 245.19 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;2H-pyridin-3-one.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;2H-pyridin-3-one |
|---|---|
| PubChem CID | 172842691 |
| Molecular Formula | C9H11NO7 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;2H-pyridin-3-one |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.O=C1C=CC=NC1 |
| InChI | InChI=1S/C5H5NO.C4H6O6/c7-5-2-1-3-6-4-5;5-1(3(7)8)2(6)4(9)10/h1-3H,4H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | WZWAXUTUJORSLR-LREBCSMRSA-N |
| XLogP | -1.93 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |