C16H23N5O3 — CID 172843622
2-[5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 172843622) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-[5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 172843622 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)N1CC2CN(c3ncc(N4CCC(O)CC4)cn3)CC2C1 |
| InChI | InChI=1S/C16H23N5O3/c22-14-1-3-19(4-2-14)13-5-17-15(18-6-13)20-7-11-9-21(16(23)24)10-12(11)8-20/h5-6,11-12,14,22H,1-4,7-10H2,(H,23,24) |
| InChIKey | XCXHBJOSHLAUOQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |