C16H36ClN — CID 172845658
3,4-diethylhexan-3-yl(triethyl)azanium chloride (PubChem CID 172845658) has the molecular formula C16H36ClN and a molecular weight of 277.92 g/mol. Its IUPAC name is 3,4-diethylhexan-3-yl(triethyl)azanium chloride.
| Compound Name | 3,4-diethylhexan-3-yl(triethyl)azanium chloride |
|---|---|
| PubChem CID | 172845658 |
| Molecular Formula | C16H36ClN |
| Molecular Weight | 277.92 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 3,4-diethylhexan-3-yl(triethyl)azanium chloride |
| SMILES | CCC(CC)C(CC)(CC)[N+](CC)(CC)CC.[Cl-] |
| InChI | InChI=1S/C16H36N.ClH/c1-8-15(9-2)16(10-3,11-4)17(12-5,13-6)14-7;/h15H,8-14H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | XJOMHEUENMAJCH-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.92 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|