C7H7FO2 — CID 172845695
2-fluoro-3a,4-dihydro-1,3-benzodioxole (PubChem CID 172845695) has the molecular formula C7H7FO2 and a molecular weight of 142.13 g/mol. Its IUPAC name is 2-fluoro-3a,4-dihydro-1,3-benzodioxole.
| Compound Name | 2-fluoro-3a,4-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 172845695 |
| Molecular Formula | C7H7FO2 |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 2-fluoro-3a,4-dihydro-1,3-benzodioxole |
| SMILES | FC1OC2=CC=CCC2O1 |
| InChI | InChI=1S/C7H7FO2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-3,6-7H,4H2 |
| InChIKey | XJRATHYWVDDGBA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |