C20H20N6OS — CID 172846110
N-[(2R)-2-[[6-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1,3-benzothiazol-2-yl]amino]cyclohexylidene]hydroxylamine (PubChem CID 172846110) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[(2R)-2-[[6-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1,3-benzothiazol-2-yl]amino]cyclohexylidene]hydroxylamine.
| Compound Name | N-[(2R)-2-[[6-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1,3-benzothiazol-2-yl]amino]cyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 172846110 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(2R)-2-[[6-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1,3-benzothiazol-2-yl]amino]cyclohexylidene]hydroxylamine |
| SMILES | ON=C1CCCC[C@H]1Nc1nc2ccc(Cc3nc4ncccc4[nH]3)cc2s1 |
| InChI | InChI=1S/C20H20N6OS/c27-26-14-5-2-1-4-13(14)23-20-24-15-8-7-12(10-17(15)28-20)11-18-22-16-6-3-9-21-19(16)25-18/h3,6-10,13,27H,1-2,4-5,11H2,(H,23,24)(H,21,22,25)/t13-/m1/s1 |
| InChIKey | XLFNSFQGZKZJNE-CYBMUJFWSA-N |
| XLogP | 4.34 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|