C20H19Cl2N5OS — CID 172814895
2-[[6-[(5,6-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol (PubChem CID 172814895) has the molecular formula C20H19Cl2N5OS and a molecular weight of 448.38 g/mol. Its IUPAC name is 2-[[6-[(5,6-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 2-[[6-[(5,6-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 172814895 |
| Molecular Formula | C20H19Cl2N5OS |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[[6-[(5,6-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCCCC1Nc1nc2ccc(Cc3nc4nc(Cl)c(Cl)cc4[nH]3)cc2s1 |
| InChI | InChI=1S/C20H19Cl2N5OS/c21-11-9-14-19(27-18(11)22)26-17(23-14)8-10-5-6-13-16(7-10)29-20(25-13)24-12-3-1-2-4-15(12)28/h5-7,9,12,15,28H,1-4,8H2,(H,24,25)(H,23,26,27) |
| InChIKey | SRHLAFADZAWXFK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|