C13H7Cl2F2N3 — CID 103977616
5,6-dichloro-2-[(3,4-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 103977616) has the molecular formula C13H7Cl2F2N3 and a molecular weight of 314.12 g/mol. Its IUPAC name is 5,6-dichloro-2-[(3,4-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-[(3,4-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103977616 |
| Molecular Formula | C13H7Cl2F2N3 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 5,6-dichloro-2-[(3,4-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Fc1ccc(Cc2nc3nc(Cl)c(Cl)cc3[nH]2)cc1F |
| InChI | InChI=1S/C13H7Cl2F2N3/c14-7-5-10-13(20-12(7)15)19-11(18-10)4-6-1-2-8(16)9(17)3-6/h1-3,5H,4H2,(H,18,19,20) |
| InChIKey | LYNOPNCYOPKWDF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|