C9H6Cl2F3N3O — CID 103208916
5,6-dichloro-2-(2,2,2-trifluoroethoxymethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 103208916) has the molecular formula C9H6Cl2F3N3O and a molecular weight of 300.07 g/mol. Its IUPAC name is 5,6-dichloro-2-(2,2,2-trifluoroethoxymethyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-(2,2,2-trifluoroethoxymethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103208916 |
| Molecular Formula | C9H6Cl2F3N3O |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 5,6-dichloro-2-(2,2,2-trifluoroethoxymethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)COCc1nc2nc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C9H6Cl2F3N3O/c10-4-1-5-8(17-7(4)11)16-6(15-5)2-18-3-9(12,13)14/h1H,2-3H2,(H,15,16,17) |
| InChIKey | LZBQJCBSAHVGON-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|