C13H6Cl2F3N3 — CID 103977488
5,6-dichloro-2-[2-(trifluoromethyl)phenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 103977488) has the molecular formula C13H6Cl2F3N3 and a molecular weight of 332.11 g/mol. Its IUPAC name is 5,6-dichloro-2-[2-(trifluoromethyl)phenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-[2-(trifluoromethyl)phenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103977488 |
| Molecular Formula | C13H6Cl2F3N3 |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 5,6-dichloro-2-[2-(trifluoromethyl)phenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)c1ccccc1-c1nc2nc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H6Cl2F3N3/c14-8-5-9-12(20-10(8)15)21-11(19-9)6-3-1-2-4-7(6)13(16,17)18/h1-5H,(H,19,20,21) |
| InChIKey | WRZKXFGBPQZHMI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|