C14H8ClF3N2 — CID 146326550
6-chloro-2-[2-(trifluoromethyl)phenyl]-1H-pyrrolo[3,2-c]pyridine (PubChem CID 146326550) has the molecular formula C14H8ClF3N2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 6-chloro-2-[2-(trifluoromethyl)phenyl]-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 6-chloro-2-[2-(trifluoromethyl)phenyl]-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 146326550 |
| Molecular Formula | C14H8ClF3N2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 6-chloro-2-[2-(trifluoromethyl)phenyl]-1H-pyrrolo[3,2-c]pyridine |
| SMILES | FC(F)(F)c1ccccc1-c1cc2cnc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H8ClF3N2/c15-13-6-11-8(7-19-13)5-12(20-11)9-3-1-2-4-10(9)14(16,17)18/h1-7,20H |
| InChIKey | LEKPWZVPGGRPHJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|