C15H13Cl2N3 — CID 103977550
5,6-dichloro-2-(4-propan-2-ylphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 103977550) has the molecular formula C15H13Cl2N3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 5,6-dichloro-2-(4-propan-2-ylphenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-(4-propan-2-ylphenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103977550 |
| Molecular Formula | C15H13Cl2N3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5,6-dichloro-2-(4-propan-2-ylphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CC(C)c1ccc(-c2nc3nc(Cl)c(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C15H13Cl2N3/c1-8(2)9-3-5-10(6-4-9)14-18-12-7-11(16)13(17)19-15(12)20-14/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | BLAXICFQCXIKJR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|