C10H3Cl4N3S — CID 114021455
5,6-dichloro-2-(2,5-dichlorothiophen-3-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 114021455) has the molecular formula C10H3Cl4N3S and a molecular weight of 339.03 g/mol. Its IUPAC name is 5,6-dichloro-2-(2,5-dichlorothiophen-3-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-(2,5-dichlorothiophen-3-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 114021455 |
| Molecular Formula | C10H3Cl4N3S |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 336.88 |
| IUPAC Name | 5,6-dichloro-2-(2,5-dichlorothiophen-3-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc(-c2nc3nc(Cl)c(Cl)cc3[nH]2)c(Cl)s1 |
| InChI | InChI=1S/C10H3Cl4N3S/c11-4-2-5-10(16-7(4)13)17-9(15-5)3-1-6(12)18-8(3)14/h1-2H,(H,15,16,17) |
| InChIKey | QOJRHQNZKMTQDU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|