C15H13Cl2N3S — CID 103977462
5,6-dichloro-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 103977462) has the molecular formula C15H13Cl2N3S and a molecular weight of 338.26 g/mol. Its IUPAC name is 5,6-dichloro-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103977462 |
| Molecular Formula | C15H13Cl2N3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5,6-dichloro-2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]c(-c3cc4c(s3)CCCCC4)nc2nc1Cl |
| InChI | InChI=1S/C15H13Cl2N3S/c16-9-7-10-14(19-13(9)17)20-15(18-10)12-6-8-4-2-1-3-5-11(8)21-12/h6-7H,1-5H2,(H,18,19,20) |
| InChIKey | KXKYDPGKESGRLO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|