C5H6F3N3OS — CID 103208776
5-(2,2,2-trifluoroethoxymethyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 103208776) has the molecular formula C5H6F3N3OS and a molecular weight of 213.18 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethoxymethyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,2,2-trifluoroethoxymethyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 103208776 |
| Molecular Formula | C5H6F3N3OS |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 5-(2,2,2-trifluoroethoxymethyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | FC(F)(F)COCc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C5H6F3N3OS/c6-5(7,8)2-12-1-3-9-4(13)11-10-3/h1-2H2,(H2,9,10,11,13) |
| InChIKey | CWIMKTUFSCUKTH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|