C14H18F2N4 — CID 82568568
5-[5-[(3,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine (PubChem CID 82568568) has the molecular formula C14H18F2N4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-[5-[(3,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine.
| Compound Name | 5-[5-[(3,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82568568 |
| Molecular Formula | C14H18F2N4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-[5-[(3,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine |
| SMILES | NCCCCCc1n[nH]c(Cc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H18F2N4/c15-11-6-5-10(8-12(11)16)9-14-18-13(19-20-14)4-2-1-3-7-17/h5-6,8H,1-4,7,9,17H2,(H,18,19,20) |
| InChIKey | VIRSXOONTMJENC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|