C14H18ClFN4 — CID 82568554
5-[5-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine (PubChem CID 82568554) has the molecular formula C14H18ClFN4 and a molecular weight of 296.78 g/mol. Its IUPAC name is 5-[5-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine.
| Compound Name | 5-[5-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82568554 |
| Molecular Formula | C14H18ClFN4 |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5-[5-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine |
| SMILES | NCCCCCc1n[nH]c(Cc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C14H18ClFN4/c15-11-5-4-6-12(16)10(11)9-14-18-13(19-20-14)7-2-1-3-8-17/h4-6H,1-3,7-9,17H2,(H,18,19,20) |
| InChIKey | WFMIWLYLDXIEGT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|