C15H19F3N4 — CID 82568579
5-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine (PubChem CID 82568579) has the molecular formula C15H19F3N4 and a molecular weight of 312.34 g/mol. Its IUPAC name is 5-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine.
| Compound Name | 5-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82568579 |
| Molecular Formula | C15H19F3N4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentan-1-amine |
| SMILES | NCCCCCc1n[nH]c(Cc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C15H19F3N4/c16-15(17,18)12-7-4-3-6-11(12)10-14-20-13(21-22-14)8-2-1-5-9-19/h3-4,6-7H,1-2,5,8-10,19H2,(H,20,21,22) |
| InChIKey | NVVAAQGXRVLKBU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|