C17H14ClF3N4O — CID 82568927
2-chloro-5-methoxy-4-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82568927) has the molecular formula C17H14ClF3N4O and a molecular weight of 382.77 g/mol. Its IUPAC name is 2-chloro-5-methoxy-4-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-chloro-5-methoxy-4-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82568927 |
| Molecular Formula | C17H14ClF3N4O |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-chloro-5-methoxy-4-[5-[[2-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1cc(N)c(Cl)cc1-c1n[nH]c(Cc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C17H14ClF3N4O/c1-26-14-8-13(22)12(18)7-10(14)16-23-15(24-25-16)6-9-4-2-3-5-11(9)17(19,20)21/h2-5,7-8H,6,22H2,1H3,(H,23,24,25) |
| InChIKey | XCUWTAXCEONEEF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|