C10H8Cl4N4O — CID 82569696
2-chloro-5-methoxy-4-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82569696) has the molecular formula C10H8Cl4N4O and a molecular weight of 342.01 g/mol. Its IUPAC name is 2-chloro-5-methoxy-4-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-chloro-5-methoxy-4-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82569696 |
| Molecular Formula | C10H8Cl4N4O |
| Molecular Weight | 342.01 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 2-chloro-5-methoxy-4-[5-(trichloromethyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1cc(N)c(Cl)cc1-c1n[nH]c(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C10H8Cl4N4O/c1-19-7-3-6(15)5(11)2-4(7)8-16-9(18-17-8)10(12,13)14/h2-3H,15H2,1H3,(H,16,17,18) |
| InChIKey | KTBQOEVZEQNKOX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.01 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|