C17H17ClN4O2 — CID 82568896
2-chloro-5-methoxy-4-[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82568896) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 2-chloro-5-methoxy-4-[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-chloro-5-methoxy-4-[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82568896 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-chloro-5-methoxy-4-[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1ccccc1Cc1nc(-c2cc(Cl)c(N)cc2OC)n[nH]1 |
| InChI | InChI=1S/C17H17ClN4O2/c1-23-14-6-4-3-5-10(14)7-16-20-17(22-21-16)11-8-12(18)13(19)9-15(11)24-2/h3-6,8-9H,7,19H2,1-2H3,(H,20,21,22) |
| InChIKey | RRIAWGBVXAEEPR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|