C16H13Cl3N4O — CID 82568924
2-chloro-4-[5-[(2,3-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline (PubChem CID 82568924) has the molecular formula C16H13Cl3N4O and a molecular weight of 383.67 g/mol. Its IUPAC name is 2-chloro-4-[5-[(2,3-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline.
| Compound Name | 2-chloro-4-[5-[(2,3-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline |
|---|---|
| PubChem CID | 82568924 |
| Molecular Formula | C16H13Cl3N4O |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-chloro-4-[5-[(2,3-dichlorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline |
| SMILES | COc1cc(N)c(Cl)cc1-c1n[nH]c(Cc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C16H13Cl3N4O/c1-24-13-7-12(20)11(18)6-9(13)16-21-14(22-23-16)5-8-3-2-4-10(17)15(8)19/h2-4,6-7H,5,20H2,1H3,(H,21,22,23) |
| InChIKey | ZFAJKCCVUGUWID-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|