C18H20ClN5O — CID 82568920
2-chloro-4-[5-[[4-(dimethylamino)phenyl]methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline (PubChem CID 82568920) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 2-chloro-4-[5-[[4-(dimethylamino)phenyl]methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline.
| Compound Name | 2-chloro-4-[5-[[4-(dimethylamino)phenyl]methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline |
|---|---|
| PubChem CID | 82568920 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-chloro-4-[5-[[4-(dimethylamino)phenyl]methyl]-1H-1,2,4-triazol-3-yl]-5-methoxyaniline |
| SMILES | COc1cc(N)c(Cl)cc1-c1n[nH]c(Cc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C18H20ClN5O/c1-24(2)12-6-4-11(5-7-12)8-17-21-18(23-22-17)13-9-14(19)15(20)10-16(13)25-3/h4-7,9-10H,8,20H2,1-3H3,(H,21,22,23) |
| InChIKey | NTIYYKMUKJEHSS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|