C20H21N5OS — CID 134465659
trans-(1R,2R)-2-[[6-[[(6-ethynylpyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol (PubChem CID 134465659) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[6-[[(6-ethynylpyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[6-[[(6-ethynylpyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134465659 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | trans-(1R,2R)-2-[[6-[[(6-ethynylpyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
| SMILES | C#Cc1cncc(NCc2ccc3nc(N[C@@H]4CCCC[C@H]4O)sc3c2)n1 |
| InChI | InChI=1S/C20H21N5OS/c1-2-14-11-21-12-19(23-14)22-10-13-7-8-16-18(9-13)27-20(25-16)24-15-5-3-4-6-17(15)26/h1,7-9,11-12,15,17,26H,3-6,10H2,(H,22,23)(H,24,25)/t15-,17-/m1/s1 |
| InChIKey | XJPANHCWTRBKOM-NVXWUHKLSA-N |
| XLogP | 3.40 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|