C25H30N6O2S — CID 134465652
(1R)-2-[[6-[[[6-(3-morpholin-4-ylprop-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol (PubChem CID 134465652) has the molecular formula C25H30N6O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is (1R)-2-[[6-[[[6-(3-morpholin-4-ylprop-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol.
| Compound Name | (1R)-2-[[6-[[[6-(3-morpholin-4-ylprop-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134465652 |
| Molecular Formula | C25H30N6O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (1R)-2-[[6-[[[6-(3-morpholin-4-ylprop-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCCC1Nc1nc2ccc(CNc3cncc(C#CCN4CCOCC4)n3)cc2s1 |
| InChI | InChI=1S/C25H30N6O2S/c32-22-6-2-1-5-20(22)29-25-30-21-8-7-18(14-23(21)34-25)15-27-24-17-26-16-19(28-24)4-3-9-31-10-12-33-13-11-31/h7-8,14,16-17,20,22,32H,1-2,5-6,9-13,15H2,(H,27,28)(H,29,30)/t20?,22-/m1/s1 |
| InChIKey | VNFUEBWEMQTWKW-LWMIZPGFSA-N |
| XLogP | 3.10 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|