About 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol
6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol (PubChem CID 142338312) has the molecular formula C18H22ClN5OS
and a molecular weight of 391.93 g/mol. Its IUPAC name is 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol.
Molecular Properties
| Compound Name | 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol |
| PubChem CID | 142338312 |
| Molecular Formula | C18H22ClN5OS |
| Molecular Weight | 391.93 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol |
| SMILES | Nc1nc2ccc(CNc3cncc(Cl)n3)cc2s1.OC1CCCCC1 |
| InChI | InChI=1S/C12H10ClN5S.C6H12O/c13-10-5-15-6-11(18-10)16-4-7-1-2-8-9(3-7)19-12(14)17-8;7-6-4-2-1-3-5-6/h1-3,5-6H,4H2,(H2,14,17)(H,16,18);6-7H,1-5H2 |
| InChIKey | KGOVOYWXZQPKQF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol?
The IUPAC name of 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol (CID 142338312) is 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol.
What is the SMILES notation for 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol?
The canonical SMILES for 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol is Nc1nc2ccc(CNc3cncc(Cl)n3)cc2s1.OC1CCCCC1.
What is the InChIKey of 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol?
The InChIKey is KGOVOYWXZQPKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN5S.C6H12O/c13-10-5-15-6-11(18-10)16-4-7-1-2-8-9(3-7)19-12(14)17-8;7-6-4-2-1-3-5-6/h1-3,5-6H,4H2,(H2,14,17)(H,16,18);6-7H,1-5H2.
What are the key properties of 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol?
6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol has a molecular weight of 391.93 g/mol, XLogP of 4.25, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(6-chloropyrazin-2-yl)amino]methyl]-1,3-benzothiazol-2-amine;cyclohexanol is sourced from PubChem (CID 142338312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).