C17H18N6S — CID 142338308
6-[[[6-(3-amino-3-methylbut-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine (PubChem CID 142338308) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is 6-[[[6-(3-amino-3-methylbut-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[[[6-(3-amino-3-methylbut-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 142338308 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 6-[[[6-(3-amino-3-methylbut-1-ynyl)pyrazin-2-yl]amino]methyl]-1,3-benzothiazol-2-amine |
| SMILES | CC(C)(N)C#Cc1cncc(NCc2ccc3nc(N)sc3c2)n1 |
| InChI | InChI=1S/C17H18N6S/c1-17(2,19)6-5-12-9-20-10-15(22-12)21-8-11-3-4-13-14(7-11)24-16(18)23-13/h3-4,7,9-10H,8,19H2,1-2H3,(H2,18,23)(H,21,22) |
| InChIKey | YLXIZZLVZBCBNF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|