C18H29O7PS — CID 172847103
(1-dibutoxyphosphoryl-1-oxopropan-2-yl) 4-methylbenzenesulfonate (PubChem CID 172847103) has the molecular formula C18H29O7PS and a molecular weight of 420.46 g/mol. Its IUPAC name is (1-dibutoxyphosphoryl-1-oxopropan-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (1-dibutoxyphosphoryl-1-oxopropan-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 172847103 |
| Molecular Formula | C18H29O7PS |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (1-dibutoxyphosphoryl-1-oxopropan-2-yl) 4-methylbenzenesulfonate |
| SMILES | CCCCOP(=O)(OCCCC)C(=O)C(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H29O7PS/c1-5-7-13-23-26(20,24-14-8-6-2)18(19)16(4)25-27(21,22)17-11-9-15(3)10-12-17/h9-12,16H,5-8,13-14H2,1-4H3 |
| InChIKey | XOLCJTNUQOMPJX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|