C34H49ClO14S2 — CID 160649722
(1-butoxy-1-oxopropan-2-yl) 2-hydroxypropanoate;butyl 2-[2-(4-methylphenyl)sulfonyloxypropanoyloxy]propanoate;4-methylbenzenesulfonyl chloride (PubChem CID 160649722) has the molecular formula C34H49ClO14S2 and a molecular weight of 781.34 g/mol. Its IUPAC name is (1-butoxy-1-oxopropan-2-yl) 2-hydroxypropanoate;butyl 2-[2-(4-methylphenyl)sulfonyloxypropanoyloxy]propanoate;4-methylbenzenesulfonyl chloride.
| Compound Name | (1-butoxy-1-oxopropan-2-yl) 2-hydroxypropanoate;butyl 2-[2-(4-methylphenyl)sulfonyloxypropanoyloxy]propanoate;4-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 160649722 |
| Molecular Formula | C34H49ClO14S2 |
| Molecular Weight | 781.34 g/mol |
| Exact Mass | 780.23 |
| IUPAC Name | (1-butoxy-1-oxopropan-2-yl) 2-hydroxypropanoate;butyl 2-[2-(4-methylphenyl)sulfonyloxypropanoyloxy]propanoate;4-methylbenzenesulfonyl chloride |
| SMILES | CCCCOC(=O)C(C)OC(=O)C(C)O.CCCCOC(=O)C(C)OC(=O)C(C)OS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C17H24O7S.C10H18O5.C7H7ClO2S/c1-5-6-11-22-16(18)13(3)23-17(19)14(4)24-25(20,21)15-9-7-12(2)8-10-15;1-4-5-6-14-10(13)8(3)15-9(12)7(2)11;1-6-2-4-7(5-3-6)11(8,9)10/h7-10,13-14H,5-6,11H2,1-4H3;7-8,11H,4-6H2,1-3H3;2-5H,1H3 |
| InChIKey | RKGKQCYPSJKGDO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 202.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|