C16H27ClN4O3S — CID 172847810
3-amino-1-cyclohexyl-1-methylthiourea;3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde;hydrochloride (PubChem CID 172847810) has the molecular formula C16H27ClN4O3S and a molecular weight of 390.94 g/mol. Its IUPAC name is 3-amino-1-cyclohexyl-1-methylthiourea;3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde;hydrochloride.
| Compound Name | 3-amino-1-cyclohexyl-1-methylthiourea;3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 172847810 |
| Molecular Formula | C16H27ClN4O3S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-amino-1-cyclohexyl-1-methylthiourea;3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde;hydrochloride |
| SMILES | CN(C(=S)NN)C1CCCCC1.Cc1ncc(CO)c(C=O)c1O.Cl |
| InChI | InChI=1S/C8H17N3S.C8H9NO3.ClH/c1-11(8(12)10-9)7-5-3-2-4-6-7;1-5-8(12)7(4-11)6(3-10)2-9-5;/h7H,2-6,9H2,1H3,(H,10,12);2,4,10,12H,3H2,1H3;1H |
| InChIKey | XQXYNRMGTRDISZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|