C12H13BrF2N2S — CID 17284856
1-(2-bromo-4,6-difluorophenyl)-3-cyclopentylthiourea (PubChem CID 17284856) has the molecular formula C12H13BrF2N2S and a molecular weight of 335.22 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3-cyclopentylthiourea.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 17284856 |
| Molecular Formula | C12H13BrF2N2S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3-cyclopentylthiourea |
| SMILES | Fc1cc(F)c(NC(=S)NC2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C12H13BrF2N2S/c13-9-5-7(14)6-10(15)11(9)17-12(18)16-8-3-1-2-4-8/h5-6,8H,1-4H2,(H2,16,17,18) |
| InChIKey | WXIXEONQIMEIMV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|