About potassium 2-indol-1-ylacetate
potassium 2-indol-1-ylacetate (PubChem CID 172851034) has the molecular formula C10H8KNO2
and a molecular weight of 213.28 g/mol. Its IUPAC name is potassium 2-indol-1-ylacetate.
Molecular Properties
| Compound Name | potassium 2-indol-1-ylacetate |
| PubChem CID | 172851034 |
| Molecular Formula | C10H8KNO2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | potassium 2-indol-1-ylacetate |
| SMILES | O=C([O-])Cn1ccc2ccccc21.[K+] |
| InChI | InChI=1S/C10H9NO2.K/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11;/h1-6H,7H2,(H,12,13);/q;+1/p-1 |
| InChIKey | YBLWTYWSQHOEQC-UHFFFAOYSA-M |
| XLogP | -2.60 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 2-indol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-indol-1-ylacetate?
The IUPAC name of potassium 2-indol-1-ylacetate (CID 172851034) is potassium 2-indol-1-ylacetate.
What is the SMILES notation for potassium 2-indol-1-ylacetate?
The canonical SMILES for potassium 2-indol-1-ylacetate is O=C([O-])Cn1ccc2ccccc21.[K+].
What is the InChIKey of potassium 2-indol-1-ylacetate?
The InChIKey is YBLWTYWSQHOEQC-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO2.K/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11;/h1-6H,7H2,(H,12,13);/q;+1/p-1.
What are the key properties of potassium 2-indol-1-ylacetate?
potassium 2-indol-1-ylacetate has a molecular weight of 213.28 g/mol, XLogP of -2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-indol-1-ylacetate is sourced from PubChem (CID 172851034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).