About (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+)
(2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) (PubChem CID 173480777) has the molecular formula C11H11N2O3RbS
and a molecular weight of 336.76 g/mol. Its IUPAC name is (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+).
Molecular Properties
| Compound Name | (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) |
| PubChem CID | 173480777 |
| Molecular Formula | C11H11N2O3RbS |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) |
| SMILES | CS(=O)(=O)[N-]C(=O)Cn1ccc2ccccc21.[Rb+] |
| InChI | InChI=1S/C11H12N2O3S.Rb/c1-17(15,16)12-11(14)8-13-7-6-9-4-2-3-5-10(9)13;/h2-7H,8H2,1H3,(H,12,14);/q;+1/p-1 |
| InChIKey | PNTVVWWVQFURNR-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 70.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+)?
The IUPAC name of (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) (CID 173480777) is (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+).
What is the SMILES notation for (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+)?
The canonical SMILES for (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) is CS(=O)(=O)[N-]C(=O)Cn1ccc2ccccc21.[Rb+].
What is the InChIKey of (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+)?
The InChIKey is PNTVVWWVQFURNR-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12N2O3S.Rb/c1-17(15,16)12-11(14)8-13-7-6-9-4-2-3-5-10(9)13;/h2-7H,8H2,1H3,(H,12,14);/q;+1/p-1.
What are the key properties of (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+)?
(2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) has a molecular weight of 336.76 g/mol, XLogP of -1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-indol-1-ylacetyl)-methylsulfonylazanide;rubidium(1+) is sourced from PubChem (CID 173480777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).