About (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide
(R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 172851761) has the molecular formula C10H19NO3S
and a molecular weight of 233.33 g/mol. Its IUPAC name is (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 172851761 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)OC[C@@H](C=N[S@](=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C10H19NO3S/c1-9(2,3)15(12)11-6-8-7-13-10(4,5)14-8/h6,8H,7H2,1-5H3/t8-,15-/m1/s1 |
| InChIKey | YDXBJKRYFUXHRJ-ANRSDYALSA-N |
| XLogP | 1.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide (CID 172851761) is (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide is CC1(C)OC[C@@H](C=N[S@](=O)C(C)(C)C)O1.
What is the InChIKey of (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is YDXBJKRYFUXHRJ-ANRSDYALSA-N. The full InChI is InChI=1S/C10H19NO3S/c1-9(2,3)15(12)11-6-8-7-13-10(4,5)14-8/h6,8H,7H2,1-5H3/t8-,15-/m1/s1.
What are the key properties of (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide?
(R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 233.33 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 172851761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).