C10H19NO3S — CID 172851761
(R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 172851761) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 172851761 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (R)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)OC[C@@H](C=N[S@](=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C10H19NO3S/c1-9(2,3)15(12)11-6-8-7-13-10(4,5)14-8/h6,8H,7H2,1-5H3/t8-,15-/m1/s1 |
| InChIKey | YDXBJKRYFUXHRJ-ANRSDYALSA-N |
| XLogP | 1.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|