C18H19N5O4 — CID 172854502
N-[amino-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-1,3-oxazole-5-carboxamide (PubChem CID 172854502) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[amino-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-1,3-oxazole-5-carboxamide.
| Compound Name | N-[amino-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 172854502 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[amino-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-1,3-oxazole-5-carboxamide |
| SMILES | N/C(=N\C(=O)c1cnco1)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C18H19N5O4/c19-16(21-17(24)15-8-20-11-26-15)14-7-6-13-9-22(14)18(25)23(13)27-10-12-4-2-1-3-5-12/h1-5,8,11,13-14H,6-7,9-10H2,(H2,19,21,24)/t13-,14+/m1/s1 |
| InChIKey | YMYMCUPUTNLGSH-KGLIPLIRSA-N |
| XLogP | 1.57 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|