C25H33NO3 — CID 17285510
heptyl 6-(4-ethylphenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate (PubChem CID 17285510) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is heptyl 6-(4-ethylphenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate.
| Compound Name | heptyl 6-(4-ethylphenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 17285510 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | heptyl 6-(4-ethylphenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
| SMILES | CCCCCCCOC(=O)c1[nH]c2c(c1C)C(=O)CC(c1ccc(CC)cc1)C2 |
| InChI | InChI=1S/C25H33NO3/c1-4-6-7-8-9-14-29-25(28)24-17(3)23-21(26-24)15-20(16-22(23)27)19-12-10-18(5-2)11-13-19/h10-13,20,26H,4-9,14-16H2,1-3H3 |
| InChIKey | TVQIWNRCMAWWKS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|