C24H22ClNO4 — CID 41123447
2-phenoxyethyl (6S)-6-(4-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate (PubChem CID 41123447) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-phenoxyethyl (6S)-6-(4-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate.
| Compound Name | 2-phenoxyethyl (6S)-6-(4-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 41123447 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-phenoxyethyl (6S)-6-(4-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
| SMILES | Cc1c(C(=O)OCCOc2ccccc2)[nH]c2c1C(=O)C[C@@H](c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C24H22ClNO4/c1-15-22-20(13-17(14-21(22)27)16-7-9-18(25)10-8-16)26-23(15)24(28)30-12-11-29-19-5-3-2-4-6-19/h2-10,17,26H,11-14H2,1H3/t17-/m0/s1 |
| InChIKey | CTOHUUMRNCKTAA-KRWDZBQOSA-N |
| XLogP | 5.13 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|