C14H17ClN2 — CID 172858062
4-(4-aminophenyl)-2,6-dimethylaniline;hydrochloride (PubChem CID 172858062) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,6-dimethylaniline;hydrochloride.
| Compound Name | 4-(4-aminophenyl)-2,6-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 172858062 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-(4-aminophenyl)-2,6-dimethylaniline;hydrochloride |
| SMILES | Cc1cc(-c2ccc(N)cc2)cc(C)c1N.Cl |
| InChI | InChI=1S/C14H16N2.ClH/c1-9-7-12(8-10(2)14(9)16)11-3-5-13(15)6-4-11;/h3-8H,15-16H2,1-2H3;1H |
| InChIKey | YZDXKQOSTPOURB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|