C16H23N2O4P — CID 175144937
4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;phosphoric acid (PubChem CID 175144937) has the molecular formula C16H23N2O4P and a molecular weight of 338.34 g/mol. Its IUPAC name is 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;phosphoric acid.
| Compound Name | 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;phosphoric acid |
|---|---|
| PubChem CID | 175144937 |
| Molecular Formula | C16H23N2O4P |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;phosphoric acid |
| SMILES | Cc1cc(-c2cc(C)c(N)c(C)c2)cc(C)c1N.O=P(O)(O)O |
| InChI | InChI=1S/C16H20N2.H3O4P/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14;1-5(2,3)4/h5-8H,17-18H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | KZHZGALODKFLQH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|