C16H22N4O4 — CID 172859664
butan-2-yl 2-(6-nitro-3-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 172859664) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is butan-2-yl 2-(6-nitro-3-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | butan-2-yl 2-(6-nitro-3-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 172859664 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | butan-2-yl 2-(6-nitro-3-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CCC(C)OC(=O)N1CC2CN(c3ccc([N+](=O)[O-])nc3)CC2C1 |
| InChI | InChI=1S/C16H22N4O4/c1-3-11(2)24-16(21)19-9-12-7-18(8-13(12)10-19)14-4-5-15(17-6-14)20(22)23/h4-6,11-13H,3,7-10H2,1-2H3 |
| InChIKey | ZEHHYZRCRISUNY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|