About CID 172861742
CID 172861742 (PubChem CID 172861742) has the molecular formula C10H12BrNNaO2
and a molecular weight of 281.11 g/mol.
Molecular Properties
| Compound Name | CID 172861742 |
| PubChem CID | 172861742 |
| Molecular Formula | C10H12BrNNaO2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | — |
| SMILES | COC(=O)C(CN)c1cccc(Br)c1.[Na] |
| InChI | InChI=1S/C10H12BrNO2.Na/c1-14-10(13)9(6-12)7-3-2-4-8(11)5-7;/h2-5,9H,6,12H2,1H3; |
| InChIKey | ZLEBJPMYNOIHBS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172861742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172861742?
The IUPAC name of CID 172861742 (CID 172861742) is not available.
What is the SMILES notation for CID 172861742?
The canonical SMILES for CID 172861742 is COC(=O)C(CN)c1cccc(Br)c1.[Na].
What is the InChIKey of CID 172861742?
The InChIKey is ZLEBJPMYNOIHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2.Na/c1-14-10(13)9(6-12)7-3-2-4-8(11)5-7;/h2-5,9H,6,12H2,1H3;.
What are the key properties of CID 172861742?
CID 172861742 has a molecular weight of 281.11 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172861742 is sourced from PubChem (CID 172861742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).