C21H17ClF2N2O4S — CID 172862888
ethyl (1S,11R)-16-chloro-17-(difluoromethoxy)-13-oxo-13λ4-thia-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14,16,18-heptaene-18-carboxylate (PubChem CID 172862888) has the molecular formula C21H17ClF2N2O4S and a molecular weight of 466.89 g/mol. Its IUPAC name is ethyl (1S,11R)-16-chloro-17-(difluoromethoxy)-13-oxo-13λ4-thia-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14,16,18-heptaene-18-carboxylate.
| Compound Name | ethyl (1S,11R)-16-chloro-17-(difluoromethoxy)-13-oxo-13λ4-thia-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14,16,18-heptaene-18-carboxylate |
|---|---|
| PubChem CID | 172862888 |
| Molecular Formula | C21H17ClF2N2O4S |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | ethyl (1S,11R)-16-chloro-17-(difluoromethoxy)-13-oxo-13λ4-thia-2,9-diazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3,5,7,9,14,16,18-heptaene-18-carboxylate |
| SMILES | CCOC(=O)c1c(OC(F)F)c(Cl)cc2c1[C@@H]1C[C@@H](CS2=O)c2nc3ccccc3n21 |
| InChI | InChI=1S/C21H17ClF2N2O4S/c1-2-29-20(27)17-16-14-7-10(19-25-12-5-3-4-6-13(12)26(14)19)9-31(28)15(16)8-11(22)18(17)30-21(23)24/h3-6,8,10,14,21H,2,7,9H2,1H3/t10-,14-,31?/m0/s1 |
| InChIKey | ZPBVVNDIZBLKBO-QRJXUJBTSA-N |
| XLogP | 4.67 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |